Difference between revisions of "PWY66-380"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4205 CPD-4205] == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-monophosphate *...")
 
(Created page with "Category:pathway == Pathway PWY66-380 == * taxonomic-range: ** tax-7742 * common-name: ** estradiol biosynthesis i (via estrone) == Reaction(s) found == * ESTRADIOL-17-B...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4205 CPD-4205] ==
+
== Pathway PWY66-380 ==
 +
* taxonomic-range:
 +
** tax-7742
 
* common-name:
 
* common-name:
** n6-(δ2-isopentenyl)-adenosine 5'-monophosphate
+
** estradiol biosynthesis i (via estrone)
* smiles:
+
== Reaction(s) found ==
** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop([o-])([o-])=o)o)o))c=nc=23)))c
+
* [[ESTRADIOL-17-BETA-DEHYDROGENASE-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** duiszflwbaprbr-sdbhatresa-l
+
* [NoneRXN66-344 RXN66-344]
* molecular-weight:
+
* [NoneRXN66-346 RXN66-346]
** 413.326
+
* [NoneRXN66-345 RXN66-345]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-7742}}
* [[RXN-4311]]
+
{{#set: common-name=estradiol biosynthesis i (via estrone)}}
* [[RXN-4313]]
+
{{#set: nb reaction found=1}}
* [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]]
+
{{#set: completion rate=0.25}}
* [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]]
+
{{#set: nb total reaction=4}}
== Reaction(s) known to produce the compound ==
 
* [[RXN-4307]]
 
* [[RXN-4311]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-monophosphate}}
 
{{#set: inchi-key=inchikey=duiszflwbaprbr-sdbhatresa-l}}
 
{{#set: molecular-weight=413.326}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY66-380

  • taxonomic-range:
    • tax-7742
  • common-name:
    • estradiol biosynthesis i (via estrone)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN66-344 RXN66-344]
  • [NoneRXN66-346 RXN66-346]
  • [NoneRXN66-345 RXN66-345]