Difference between revisions of "2-KETO-3-DEOXY-6-P-GLUCONATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE == * common-name: ** n1-(5-phospho-β-d-ribosyl)glycinamide * smiles: ** c([n+])c(=o)nc1(c(o)c(o)c(cop...")
(Created page with "Category:metabolite == Metabolite 2-KETO-3-DEOXY-6-P-GLUCONATE == * common-name: ** 2-dehydro-3-deoxy-d-gluconate 6-phosphate * smiles: ** c(=o)([o-])c(=o)cc(o)c(o)cop([o-...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE ==
+
== Metabolite 2-KETO-3-DEOXY-6-P-GLUCONATE ==
 
* common-name:
 
* common-name:
−
** n1-(5-phospho-β-d-ribosyl)glycinamide
+
** 2-dehydro-3-deoxy-d-gluconate 6-phosphate
 
* smiles:
 
* smiles:
−
** c([n+])c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
+
** c(=o)([o-])c(=o)cc(o)c(o)cop([o-])(=o)[o-]
 
* inchi-key:
 
* inchi-key:
−
** obqmlsfouzuiob-shuuezrqsa-m
+
** ovprppovaxrced-wvzvxsggsa-k
 
* molecular-weight:
 
* molecular-weight:
−
** 285.17
+
** 255.098
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[FPGFTh]]
+
* [[KDPGALDOL-RXN]]
−
* [[GART-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[FGFTh]]
+
* [[PGLUCONDEHYDRAT-RXN]]
−
* [[FPGFTh]]
 
−
* [[GART-RXN]]
 
−
* [[GLYRIBONUCSYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=n1-(5-phospho-β-d-ribosyl)glycinamide}}
+
{{#set: common-name=2-dehydro-3-deoxy-d-gluconate 6-phosphate}}
−
{{#set: inchi-key=inchikey=obqmlsfouzuiob-shuuezrqsa-m}}
+
{{#set: inchi-key=inchikey=ovprppovaxrced-wvzvxsggsa-k}}
−
{{#set: molecular-weight=285.17}}
+
{{#set: molecular-weight=255.098}}

Latest revision as of 11:15, 18 March 2021

Metabolite 2-KETO-3-DEOXY-6-P-GLUCONATE

  • common-name:
    • 2-dehydro-3-deoxy-d-gluconate 6-phosphate
  • smiles:
    • c(=o)([o-])c(=o)cc(o)c(o)cop([o-])(=o)[o-]
  • inchi-key:
    • ovprppovaxrced-wvzvxsggsa-k
  • molecular-weight:
    • 255.098

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=2-KETO-3-DEOXY-6-P-GLUCONATE&oldid=138790"