|
|
| (9 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMATESYN-RXN GLUTAMATESYN-RXN] == | + | == Metabolite CPD-3481 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** l-glutamate:nadp+ oxidoreductase (transaminating) | + | ** bupropion |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/1.4.1.13 ec-1.4.1.13] | + | ** cc([n+]c(c)(c)c)c(=o)c1(c=cc=c(cl)c=1) |
| − | == Reaction formula ==
| + | * inchi-key: |
| − | * 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[GLN]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 2 [[GLT]][c] '''+''' 1 [[NADP]][c]
| + | ** snppwiuozrmyny-uhfffaoysa-o |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ20190]] | + | ** 240.752 |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[RXN66-181]] |
| − | * Gene: [[SJ10812]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[annotation]]
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: common-name=bupropion}} |
| − | ** Category: [[orthology]]
| + | {{#set: inchi-key=inchikey=snppwiuozrmyny-uhfffaoysa-o}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: molecular-weight=240.752}} |
| − | * Gene: [[SJ10813]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ04922]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | == Pathway(s) == | |
| − | * [[GLUTSYN-PWY]], L-glutamate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLUTSYN-PWY GLUTSYN-PWY] | |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[GLUTAMINEFUM-PWY]], L-glutamine degradation II: [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMINEFUM-PWY GLUTAMINEFUM-PWY]
| |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15503 15503]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R00114 R00114]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/Q05756 Q05756]
| |
| − | ** [http://www.uniprot.org/uniprot/Q05755 Q05755]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PJA4 Q9PJA4]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PJA2 Q9PJA2]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CG25 Q9CG25]
| |
| − | ** [http://www.uniprot.org/uniprot/Q58746 Q58746]
| |
| − | ** [http://www.uniprot.org/uniprot/P09831 P09831]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CG24 Q9CG24]
| |
| − | ** [http://www.uniprot.org/uniprot/P09832 P09832]
| |
| − | ** [http://www.uniprot.org/uniprot/P39812 P39812]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9S2Y9 Q9S2Y9]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=l-glutamate:nadp+ oxidoreductase (transaminating)}} | |
| − | {{#set: ec-number=ec-1.4.1.13}} | |
| − | {{#set: nb gene associated=4}} | |
| − | {{#set: nb pathway associated=2}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools|pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
