Difference between revisions of "Digalactosylceramide-sulfate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N6N6N6-TRIMETHYL-L-LYSINE == * common-name: ** n6,n6,n6-trimethyl-l-lysine * smiles: ** c[n+](ccccc(c([o-])=o)[n+])(c)c * inchi-key: ** m...") |
(Created page with "Category:metabolite == Metabolite Digalactosylceramide-sulfate == * common-name: ** a digalactosylceramide sulfate == Reaction(s) known to consume the compound == == React...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Digalactosylceramide-sulfate == |
* common-name: | * common-name: | ||
| − | ** | + | ** a digalactosylceramide sulfate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-18303]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a digalactosylceramide sulfate}} |
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite Digalactosylceramide-sulfate
- common-name:
- a digalactosylceramide sulfate
