Difference between revisions of "3-MERCAPTO-PYRUVATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3061 == * common-name: ** (2s)-liquiritigenin * smiles: ** c1(c=c(c=cc=1c3(oc2(=cc(=cc=c2c(c3)=o)o)))o) * inchi-key: ** furuxtvzlhccn...") |
(Created page with "Category:metabolite == Metabolite 3-MERCAPTO-PYRUVATE == * common-name: ** 3-mercaptopyruvate * smiles: ** c(c(c(=o)[o-])=o)s * inchi-key: ** ojolfaigoxzbci-uhfffaoysa-m *...") |
||
| (3 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-MERCAPTO-PYRUVATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-mercaptopyruvate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c(c(=o)[o-])=o)s |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ojolfaigoxzbci-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 119.115 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[CYSTEINE-AMINOTRANSFERASE-RXN]] | ||
| + | * [[MERCAPYSTRANS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[CYSTEINE-AMINOTRANSFERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-mercaptopyruvate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ojolfaigoxzbci-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=119.115}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite 3-MERCAPTO-PYRUVATE
- common-name:
- 3-mercaptopyruvate
- smiles:
- c(c(c(=o)[o-])=o)s
- inchi-key:
- ojolfaigoxzbci-uhfffaoysa-m
- molecular-weight:
- 119.115
