|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9680 RXN-9680] == | + | == Metabolite DIHYDROXYNAPHTHOATE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** dimethylglycine-betaine methyltransferase | + | ** 2-carboxy-1,4-naphthoquinol |
| − | * ec-number:
| + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/2.1.1.161 ec-2.1.1.161]
| + | ** c([o-])(=o)c1(=c(o)c2(=c(c(o)=c1)c=cc=c2)) |
| − | * synonymous: | + | * inchi-key: |
| − | ** sdmt | + | ** vojuxhhacrxltd-uhfffaoysa-m |
| − | ** s-adenosyl-l-methionine:n,n-dimethylglycine n-methyltransferase
| + | * molecular-weight: |
| − | ** sarcosine-dimethylglycine methyltransferase
| + | ** 203.174 |
| − | ** glycine sarcosine dimethylglycine n-methyltransferase
| + | == Reaction(s) known to consume the compound == |
| − | ** gsdmt
| + | * [[NPHS]] |
| − | ** apdmt
| + | == Reaction(s) known to produce the compound == |
| − | ** sarcosine dimethylglycine n-methyltransferase
| + | == Reaction(s) of unknown directionality == |
| − | == Reaction formula ==
| + | {{#set: common-name=2-carboxy-1,4-naphthoquinol}} |
| − | * 1 [[DIMETHYL-GLYCINE]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[BETAINE]][c] '''+''' 1 [[PROTON]][c]
| + | {{#set: inchi-key=inchikey=vojuxhhacrxltd-uhfffaoysa-m}} |
| − | == Gene(s) associated with this reaction ==
| + | {{#set: molecular-weight=203.174}} |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * Gene: [[SJ12118]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ10116]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ12128]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ12119]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ11087]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ14716]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ18177]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | * Gene: [[SJ12116]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | * Gene: [[SJ03081]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ02539]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ02540]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[P541-PWY]], glycine betaine biosynthesis IV (from glycine): [http://metacyc.org/META/NEW-IMAGE?object=P541-PWY P541-PWY] | |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-6004]], glycine betaine biosynthesis V (from glycine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6004 PWY-6004]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10073 10073]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R07244 R07244]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=dimethylglycine-betaine methyltransferase}} | |
| − | {{#set: ec-number=ec-2.1.1.161}}
| |
| − | {{#set: synonymous=sarcosine dimethylglycine n-methyltransferase|s-adenosyl-l-methionine:n,n-dimethylglycine n-methyltransferase|apdmt|gsdmt|glycine sarcosine dimethylglycine n-methyltransferase|sarcosine-dimethylglycine methyltransferase|sdmt}}
| |
| − | {{#set: nb gene associated=11}} | |
| − | {{#set: nb pathway associated=2}}
| |
| − | {{#set: reconstruction category=annotation}} | |
| − | {{#set: reconstruction tool=pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome}}
| |
