Difference between revisions of "D-Glucosyl-12-diacyl-glycerols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OLEATE-CPD == * common-name: ** oleate * smiles: ** ccccccccc=ccccccccc([o-])=o * inchi-key: ** zqppmhvwecsirj-ktkrtigzsa-m * molecular-w...") |
(Created page with "Category:metabolite == Metabolite D-Glucosyl-12-diacyl-glycerols == * common-name: ** a 1,2-diacyl-3-o-(β-d-glucopyranosyl)-sn-glycerol == Reaction(s) known to consum...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-Glucosyl-12-diacyl-glycerols == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 1,2-diacyl-3-o-(β-d-glucopyranosyl)-sn-glycerol |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-15117]] | |
| − | * [[RXN- | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 1,2-diacyl-3-o-(β-d-glucopyranosyl)-sn-glycerol}} |
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite D-Glucosyl-12-diacyl-glycerols
- common-name:
- a 1,2-diacyl-3-o-(β-d-glucopyranosyl)-sn-glycerol
