Difference between revisions of "THIOCYSTEINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-596 == * common-name: ** n6,n6-dimethyl-l-arginine * smiles: ** cn(c(=[n+])ncccc([n+])c(=o)[o-])c * inchi-key: ** ydgmgexadbmomj-lurj...") |
(Created page with "Category:metabolite == Metabolite THIOCYSTEINE == * common-name: ** thiocysteine * smiles: ** c(ss)c(c([o-])=o)[n+] * inchi-key: ** xbkonscrebsmcs-reohclbhsa-n * molecular...") |
||
(3 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite THIOCYSTEINE == |
* common-name: | * common-name: | ||
− | ** | + | ** thiocysteine |
* smiles: | * smiles: | ||
− | ** | + | ** c(ss)c(c([o-])=o)[n+] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** xbkonscrebsmcs-reohclbhsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 153.214 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[CYSTHIOCYS-RXN]] | ||
+ | * [[RXN-15128]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=thiocysteine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xbkonscrebsmcs-reohclbhsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=153.214}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite THIOCYSTEINE
- common-name:
- thiocysteine
- smiles:
- c(ss)c(c([o-])=o)[n+]
- inchi-key:
- xbkonscrebsmcs-reohclbhsa-n
- molecular-weight:
- 153.214