Difference between revisions of "4-P-PANTOTHENATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Protein-L-methionine-R-S-oxides == * common-name: ** a protein-l-methionine-(r)-s-oxide == Reaction(s) known to consume the compound == *...")
(Created page with "Category:metabolite == Metabolite 4-P-PANTOTHENATE == * common-name: ** (r)-4'-phosphopantothenate * smiles: ** cc(c(c(=o)nccc(=o)[o-])o)(cop([o-])([o-])=o)c * inchi-key:...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Protein-L-methionine-R-S-oxides ==
+
== Metabolite 4-P-PANTOTHENATE ==
 
* common-name:
 
* common-name:
** a protein-l-methionine-(r)-s-oxide
+
** (r)-4'-phosphopantothenate
 +
* smiles:
 +
** cc(c(c(=o)nccc(=o)[o-])o)(cop([o-])([o-])=o)c
 +
* inchi-key:
 +
** xhfvghpgdldeqo-zetcqymhsa-k
 +
* molecular-weight:
 +
** 296.193
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.8.4.12-RXN]]
+
* [[P-PANTOCYSLIG-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.8.4.12-RXN]]
+
* [[PANTOTHENATE-KIN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a protein-l-methionine-(r)-s-oxide}}
+
{{#set: common-name=(r)-4'-phosphopantothenate}}
 +
{{#set: inchi-key=inchikey=xhfvghpgdldeqo-zetcqymhsa-k}}
 +
{{#set: molecular-weight=296.193}}

Latest revision as of 11:16, 18 March 2021

Metabolite 4-P-PANTOTHENATE

  • common-name:
    • (r)-4'-phosphopantothenate
  • smiles:
    • cc(c(c(=o)nccc(=o)[o-])o)(cop([o-])([o-])=o)c
  • inchi-key:
    • xhfvghpgdldeqo-zetcqymhsa-k
  • molecular-weight:
    • 296.193

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality