Difference between revisions of "CPD-14423"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PYRIDOXINE-5P == * common-name: ** pyridoxine 5'-phosphate * smiles: ** cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co) * inchi-key: ** whomfkwh...")
(Created page with "Category:metabolite == Metabolite CPD-14423 == * common-name: ** 3-oxo-docosapentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop...")
 
(3 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PYRIDOXINE-5P ==
+
== Metabolite CPD-14423 ==
 
* common-name:
 
* common-name:
** pyridoxine 5'-phosphate
+
** 3-oxo-docosapentaenoyl-coa
 
* smiles:
 
* smiles:
** cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co)
+
** ccc=ccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** whomfkwhiqzthy-uhfffaoysa-l
+
** slykkqsprfjdaf-hvganwhpsa-j
 
* molecular-weight:
 
* molecular-weight:
** 247.144
+
** 1089.98
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PNPOXI-RXN]]
+
* [[RXN-13443]]
* [[RXN-14181]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PNKIN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pyridoxine 5'-phosphate}}
+
{{#set: common-name=3-oxo-docosapentaenoyl-coa}}
{{#set: inchi-key=inchikey=whomfkwhiqzthy-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=slykkqsprfjdaf-hvganwhpsa-j}}
{{#set: molecular-weight=247.144}}
+
{{#set: molecular-weight=1089.98}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-14423

  • common-name:
    • 3-oxo-docosapentaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • slykkqsprfjdaf-hvganwhpsa-j
  • molecular-weight:
    • 1089.98

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality