Difference between revisions of "CPD-6993"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3b-hydroxy-D5-steroids == * common-name: ** a 3β-hydroxy-δ5-steroid == Reaction(s) known to consume the compound == * 1.1.1....") |
(Created page with "Category:metabolite == Metabolite CPD-6993 == * common-name: ** pinocembrin chalcone * smiles: ** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2) * inchi-key: ** loyxtwzxlwh...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-6993 == |
* common-name: | * common-name: | ||
− | ** | + | ** pinocembrin chalcone |
+ | * smiles: | ||
+ | ** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2) | ||
+ | * inchi-key: | ||
+ | ** loyxtwzxlwhmbx-votsokgwsa-n | ||
+ | * molecular-weight: | ||
+ | ** 256.257 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-7647]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-7645]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=pinocembrin chalcone}} |
+ | {{#set: inchi-key=inchikey=loyxtwzxlwhmbx-votsokgwsa-n}} | ||
+ | {{#set: molecular-weight=256.257}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-6993
- common-name:
- pinocembrin chalcone
- smiles:
- c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2)
- inchi-key:
- loyxtwzxlwhmbx-votsokgwsa-n
- molecular-weight:
- 256.257