Difference between revisions of "CPD-12117"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Guanine37-in-tRNAPhe == * common-name: ** guanine37 in trnaphe == Reaction(s) known to consume the compound == * RXN-14517 == Reactio...")
(Created page with "Category:metabolite == Metabolite CPD-12117 == * common-name: ** demethylmenaquinol-7 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=c...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Guanine37-in-tRNAPhe ==
+
== Metabolite CPD-12117 ==
 
* common-name:
 
* common-name:
** guanine37 in trnaphe
+
** demethylmenaquinol-7
 +
* smiles:
 +
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
 +
* inchi-key:
 +
** ufzdimbxtvrbds-ssqlmynasa-n
 +
* molecular-weight:
 +
** 636.999
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14517]]
+
* [[RXN-9191]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=guanine37 in trnaphe}}
+
{{#set: common-name=demethylmenaquinol-7}}
 +
{{#set: inchi-key=inchikey=ufzdimbxtvrbds-ssqlmynasa-n}}
 +
{{#set: molecular-weight=636.999}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-12117

  • common-name:
    • demethylmenaquinol-7
  • smiles:
    • cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
  • inchi-key:
    • ufzdimbxtvrbds-ssqlmynasa-n
  • molecular-weight:
    • 636.999

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality