Difference between revisions of "DIMETHYLARSINATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite AMINO-PARATHION == * common-name: ** amino-parathion * smiles: ** ccop(oc1(c=cc(=cc=1)n))(occ)=s * inchi-key: ** xizotxgjxstqdi-uhfffaoys...") |
(Created page with "Category:metabolite == Metabolite DIMETHYLARSINATE == * common-name: ** cacodylate * smiles: ** c[as](c)(=o)[o-] * inchi-key: ** oggxgzamxpvrfz-uhfffaoysa-m * molecular-we...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DIMETHYLARSINATE == |
* common-name: | * common-name: | ||
− | ** | + | ** cacodylate |
* smiles: | * smiles: | ||
− | ** | + | ** c[as](c)(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** oggxgzamxpvrfz-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 136.99 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[2.1.1.138-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=cacodylate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oggxgzamxpvrfz-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=136.99}} |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite DIMETHYLARSINATE
- common-name:
- cacodylate
- smiles:
- c[as](c)(=o)[o-]
- inchi-key:
- oggxgzamxpvrfz-uhfffaoysa-m
- molecular-weight:
- 136.99