Difference between revisions of "CPD-12119"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8301 RXN-8301] == * direction: ** left-to-right * common-name: ** 1-18:2-2-16:3-monogalactosyld...")
 
(Created page with "Category:metabolite == Metabolite CPD-12119 == * common-name: ** demethylmenaquinol-10 * smiles: ** cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8301 RXN-8301] ==
+
== Metabolite CPD-12119 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 1-18:2-2-16:3-monogalactosyldiacylglycerol desaturase
+
** demethylmenaquinol-10
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.14.19.35 ec-1.14.19.35]
+
** cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-8080]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''+''' 2 [[Reduced-ferredoxins]][c] '''=>''' 1 [[CPD-2190]][c] '''+''' 2 [[Oxidized-ferredoxins]][c] '''+''' 2 [[WATER]][c]
+
** fnbtzsjwsslppl-alcxcgrtsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ09228]]
+
** 841.354
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-9361]]
−
* Gene: [[SJ03069]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=demethylmenaquinol-10}}
−
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=fnbtzsjwsslppl-alcxcgrtsa-n}}
−
* [[PWY-782]], glycolipid desaturation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-782 PWY-782]
+
{{#set: molecular-weight=841.354}}
−
** '''16''' reactions found over '''28''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=1-18:2-2-16:3-monogalactosyldiacylglycerol desaturase}}
 
−
{{#set: ec-number=ec-1.14.19.35}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-12119

  • common-name:
    • demethylmenaquinol-10
  • smiles:
    • cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c
  • inchi-key:
    • fnbtzsjwsslppl-alcxcgrtsa-n
  • molecular-weight:
    • 841.354

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-12119&oldid=138993"