|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN-311 TRANS-RXN-311] == | + | == Metabolite CPD-201 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** multidrug abc exporter | + | ** 4-hydroxybenzoyl-coa |
| − | ** xenobiotic-transporting atpase
| + | * smiles: |
| − | * ec-number: | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(c1(=cc=c(o)c=c1))=o)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-] |
| − | ** [http://enzyme.expasy.org/EC/3.6.3.44 ec-3.6.3.44] | + | * inchi-key: |
| − | == Reaction formula ==
| + | ** ltvxpvbfjbtnij-tyhxjlicsa-j |
| − | * 1 [[ATP]][c] '''+''' 1 [[Drugs]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[Drugs]][e] '''+''' 1 [[Pi]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction == | + | ** 883.61 |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to consume the compound == |
| − | * Gene: [[SJ14054]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[annotation]]
| + | * [[RXN-11246]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | * Gene: [[SJ22252]]
| + | {{#set: common-name=4-hydroxybenzoyl-coa}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=ltvxpvbfjbtnij-tyhxjlicsa-j}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | {{#set: molecular-weight=883.61}} |
| − | * Gene: [[SJ20699]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ21587]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ20268]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ20270]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ14254]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ17871]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ15002]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ01608]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ20269]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ22251]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ08362]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ20458]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ16737]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | == External links == | |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=xenobiotic-transporting atpase|multidrug abc exporter}} | |
| − | {{#set: ec-number=ec-3.6.3.44}} | |
| − | {{#set: nb gene associated=15}} | |
| − | {{#set: nb pathway associated=0}}
| |
| − | {{#set: reconstruction category=annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome}}
| |
