Difference between revisions of "D-SEDOHEPTULOSE-1-7-P2"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14195 RXN-14195] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:metabolite == Metabolite D-SEDOHEPTULOSE-1-7-P2 == * common-name: ** d-sedoheptulose-1,7-bisphosphate * smiles: ** c(op(=o)([o-])[o-])c(o)c(o)c(o)c(o)c(cop([o-])(...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite D-SEDOHEPTULOSE-1-7-P2 == |
− | * | + | * common-name: |
− | ** | + | ** d-sedoheptulose-1,7-bisphosphate |
− | * | + | * smiles: |
− | ** [ | + | ** c(op(=o)([o-])[o-])c(o)c(o)c(o)c(o)c(cop([o-])(=o)[o-])=o |
− | + | * inchi-key: | |
− | + | ** okhxougreccasi-shuuezrqsa-j | |
− | + | * molecular-weight: | |
− | * | + | ** 366.112 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | *** | + | * [[SEDOBISALDOL-RXN]] |
− | == | + | * [[SEDOHEPTULOSE-BISPHOSPHATASE-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[SEDOBISALDOL-RXN]] |
− | == | + | == Reaction(s) of unknown directionality == |
− | {{#set: | + | {{#set: common-name=d-sedoheptulose-1,7-bisphosphate}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=okhxougreccasi-shuuezrqsa-j}} |
− | {{#set: | + | {{#set: molecular-weight=366.112}} |
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite D-SEDOHEPTULOSE-1-7-P2
- common-name:
- d-sedoheptulose-1,7-bisphosphate
- smiles:
- c(op(=o)([o-])[o-])c(o)c(o)c(o)c(o)c(cop([o-])(=o)[o-])=o
- inchi-key:
- okhxougreccasi-shuuezrqsa-j
- molecular-weight:
- 366.112