Difference between revisions of "CPD-11937"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACHMSSELCYSL ACHMSSELCYSL] == * direction: ** left-to-right * common-name: ** o-acetylhomoserine su...") |
(Created page with "Category:metabolite == Metabolite CPD-11937 == * common-name: ** 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate * smiles: ** c1(op([o-])(=o)[o-])(c(op([o-])(=o)...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-11937 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate |
− | + | * smiles: | |
− | * | + | ** c1(op([o-])(=o)[o-])(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op(o)(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)1) |
− | == | + | * inchi-key: |
− | * | + | ** uphpwxpnziozjl-ptqmnwpwsa-b |
− | * | + | * molecular-weight: |
− | * | + | ** 727.921 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-10973]] | |
− | * | + | * [[RXN-10976]] |
− | == | + | * [[RXN-10978]] |
− | + | == Reaction(s) known to produce the compound == | |
− | {{#set: common-name= | + | * [[RXN-10971]] |
− | {{#set: | + | * [[RXN-10976]] |
− | + | * [[RXN-10978]] | |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate}} | |
− | + | {{#set: inchi-key=inchikey=uphpwxpnziozjl-ptqmnwpwsa-b}} | |
− | + | {{#set: molecular-weight=727.921}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-11937
- common-name:
- 1d-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
- smiles:
- c1(op([o-])(=o)[o-])(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op(o)(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)1)
- inchi-key:
- uphpwxpnziozjl-ptqmnwpwsa-b
- molecular-weight:
- 727.921