Difference between revisions of "OXALO-SUCCINATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14146 RXN-14146] == * direction: ** reversible * ec-number: ** [http://enzyme.expasy.org/EC/4.1...")
 
(Created page with "Category:metabolite == Metabolite OXALO-SUCCINATE == * common-name: ** oxalosuccinate * smiles: ** c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o * inchi-key: ** ufscuaxltrfidc-uh...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14146 RXN-14146] ==
+
== Metabolite OXALO-SUCCINATE ==
−
* direction:
+
* common-name:
−
** reversible
+
** oxalosuccinate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.1.2 ec-4.1.2]
+
** c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-15125]][c] '''<=>''' 1 [[PYRUVATE]][c] '''+''' 1 [[SUCC-S-ALD]][c]
+
** ufscuaxltrfidc-uhfffaoysa-k
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ06446]]
+
** 187.085
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-8642]]
−
== Pathway(s) ==
+
* [[RXN-9951]]
−
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[RXN-8642]]
−
== External links  ==
+
* [[RXN-9951]]
−
* LIGAND-RXN:
+
== Reaction(s) of unknown directionality ==
−
** [http://www.genome.jp/dbget-bin/www_bget?R01647 R01647]
+
{{#set: common-name=oxalosuccinate}}
−
* RHEA:
+
{{#set: inchi-key=inchikey=ufscuaxltrfidc-uhfffaoysa-k}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25791 25791]
+
{{#set: molecular-weight=187.085}}
−
{{#set: direction=reversible}}
 
−
{{#set: ec-number=ec-4.1.2}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite OXALO-SUCCINATE

  • common-name:
    • oxalosuccinate
  • smiles:
    • c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o
  • inchi-key:
    • ufscuaxltrfidc-uhfffaoysa-k
  • molecular-weight:
    • 187.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=OXALO-SUCCINATE&oldid=139234"