Difference between revisions of "DEOXYGUANOSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7658 RXN-7658] == * direction: ** reversible * common-name: ** geranylgeranyl diphosphate reduc...")
 
(Created page with "Category:metabolite == Metabolite DEOXYGUANOSINE == * common-name: ** 2'-deoxyguanosine * smiles: ** c(o)c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** ykbgvtzy...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7658 RXN-7658] ==
+
== Metabolite DEOXYGUANOSINE ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** geranylgeranyl diphosphate reductase
+
** 2'-deoxyguanosine
−
== Reaction formula ==
+
* smiles:
−
* 1 [[CPD-7002]][c] '''+''' 1 [[NADP]][c] '''<=>''' 1 [[GERANYLGERANYL-PP]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c]
+
** c(o)c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ15264]]
+
** ykbgvtzyehremt-kvqbguixsa-n
−
** Category: [[annotation]]
+
* molecular-weight:
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
** 267.244
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[DEOXYGUANPHOSPHOR-RXN]]
−
== Pathway(s) ==
+
* [[DMPH]]
−
* [[PWY-5063]], phytyl diphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5063 PWY-5063]
+
== Reaction(s) known to produce the compound ==
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
* [[DEOXYGUANPHOSPHOR-RXN]]
−
== Reconstruction information  ==
+
* [[DGTPTRIPHYDRO-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[DMPH]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=2'-deoxyguanosine}}
−
* LIGAND-RXN:
+
{{#set: inchi-key=inchikey=ykbgvtzyehremt-kvqbguixsa-n}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R08754 R08754]
+
{{#set: molecular-weight=267.244}}
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=geranylgeranyl diphosphate reductase}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite DEOXYGUANOSINE

  • common-name:
    • 2'-deoxyguanosine
  • smiles:
    • c(o)c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • ykbgvtzyehremt-kvqbguixsa-n
  • molecular-weight:
    • 267.244

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=DEOXYGUANOSINE&oldid=139244"