Difference between revisions of "CPD1F-129"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GMP-SYN-NH3-RXN GMP-SYN-NH3-RXN] == * direction: ** left-to-right * common-name: ** xanthosine-5'-p...")
 
(Created page with "Category:metabolite == Metabolite CPD1F-129 == * common-name: ** β-carotene * smiles: ** cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GMP-SYN-NH3-RXN GMP-SYN-NH3-RXN] ==
+
== Metabolite CPD1F-129 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** xanthosine-5'-phosphate:ammonia ligase (amp-forming)
+
** β-carotene
== Reaction formula ==
+
* smiles:
* 1 [[AMMONIUM]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[XANTHOSINE-5-PHOSPHATE]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[GMP]][c] '''+''' 1 [[PPI]][c] '''+''' 2 [[PROTON]][c]
+
** cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c
== Gene(s) associated with this reaction  ==
+
* inchi-key:
* Gene: [[SJ08788]]
+
** oenhqhleoonyie-jltxgrslsa-n
** Category: [[annotation]]
+
* molecular-weight:
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
** 536.882
* Gene: [[SJ22386]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
* [[RXN-13641]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-8025]]
** Category: [[orthology]]
+
* [[RXN1F-152]]
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-13641]]
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN1F-151]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
== Pathway(s) ==
+
{{#set: common-name=β-carotene}}
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=oenhqhleoonyie-jltxgrslsa-n}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=536.882}}
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18302 18302]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R01230 R01230]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=xanthosine-5'-phosphate:ammonia ligase (amp-forming)}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina|output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD1F-129

  • common-name:
    • β-carotene
  • smiles:
    • cc(c=cc=c(c=cc1(c(c)(c)cccc=1c))c)=cc=cc=c(c=cc=c(c=cc2(=c(cccc(c)(c)2)c))c)c
  • inchi-key:
    • oenhqhleoonyie-jltxgrslsa-n
  • molecular-weight:
    • 536.882

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality