Difference between revisions of "ANTHRANILATE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UMPP UMPP] == * direction: ** left-to-right * common-name: ** uridine 5'-monophosphate phosphohydro...") |
(Created page with "Category:metabolite == Metabolite ANTHRANILATE == * common-name: ** anthranilate * smiles: ** c(c1(c(=cc=cc=1)n))(=o)[o-] * inchi-key: ** rwzyaggxghygmb-uhfffaoysa-m * mol...") |
||
| (9 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite ANTHRANILATE == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** anthranilate |
| − | + | * smiles: | |
| − | * | + | ** c(c1(c(=cc=cc=1)n))(=o)[o-] |
| − | == | + | * inchi-key: |
| − | * | + | ** rwzyaggxghygmb-uhfffaoysa-m |
| − | * | + | * molecular-weight: |
| − | + | ** 136.13 | |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[ANTHRANSYN-RXN]] | |
| − | * | + | * [[PRTRANS-RXN]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | + | * [[ANTHRANSYN-RXN]] | |
| − | {{#set: common-name= | + | * [[PRTRANS-RXN]] |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=anthranilate}} | |
| − | {{#set: | + | {{#set: inchi-key=inchikey=rwzyaggxghygmb-uhfffaoysa-m}} |
| − | + | {{#set: molecular-weight=136.13}} | |
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite ANTHRANILATE
- common-name:
- anthranilate
- smiles:
- c(c1(c(=cc=cc=1)n))(=o)[o-]
- inchi-key:
- rwzyaggxghygmb-uhfffaoysa-m
- molecular-weight:
- 136.13
