|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CHD-RXN CHD-RXN] == | + | == Metabolite CPD-10814 == |
| − | * direction:
| |
| − | ** reversible
| |
| | * common-name: | | * common-name: |
| − | ** choline dehydrogenase | + | ** glycyl-l-proline |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/1.1.99.1 ec-1.1.99.1] | + | ** c1(n(c(=o)c[n+])c(cc1)c(=o)[o-]) |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[Acceptor]][c] '''+''' 1 [[CHOLINE]][c] '''<=>''' 1 [[BETAINE_ALDEHYDE]][c] '''+''' 1 [[Donor-H2]][c]
| + | ** kznqnbzmbzjqjo-yfkpbyrvsa-n |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ12409]]
| + | ** 172.183 |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | * [[RXN0-6988]] |
| − | * Gene: [[SJ09287]]
| + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[annotation]]
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | {{#set: common-name=glycyl-l-proline}} |
| − | ** Category: [[orthology]]
| + | {{#set: inchi-key=inchikey=kznqnbzmbzjqjo-yfkpbyrvsa-n}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: molecular-weight=172.183}} |
| − | * Gene: [[SJ06047]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | * Gene: [[SJ22552]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ07158]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | == Pathway(s) == | |
| − | * [[BETSYN-PWY]], glycine betaine biosynthesis I (Gram-negative bacteria): [http://metacyc.org/META/NEW-IMAGE?object=BETSYN-PWY BETSYN-PWY] | |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[CHOLINE-BETAINE-ANA-PWY]], choline degradation I: [http://metacyc.org/META/NEW-IMAGE?object=CHOLINE-BETAINE-ANA-PWY CHOLINE-BETAINE-ANA-PWY]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17436 17436]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R01025 R01025]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P17444 P17444]
| |
| − | {{#set: direction=reversible}}
| |
| − | {{#set: common-name=choline dehydrogenase}} | |
| − | {{#set: ec-number=ec-1.1.99.1}}
| |
| − | {{#set: nb gene associated=5}} | |
| − | {{#set: nb pathway associated=2}}
| |
| − | {{#set: reconstruction category=orthology|annotation}} | |
| − | {{#set: reconstruction tool=pathwaytools|pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
