Difference between revisions of "OCTAPRENYL-METHYL-METHOXY-BENZQ"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17788 RXN-17788] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ == * common-name: ** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=ccc...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17788 RXN-17788] ==
+
== Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ ==
* direction:
+
* common-name:
** left-to-right
+
** 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.3.8 ec-1.3.8]
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-10269]][c] '''+''' 1 [[ETF-Oxidized]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-19162]][c] '''+''' 1 [[ETF-Reduced]][c]
+
** hdsgdgslnmimku-kfsstaeesa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ21233]]
+
** 699.111
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
* Gene: [[SJ04334]]
+
* [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol}}
* Gene: [[SJ15262]]
+
{{#set: inchi-key=inchikey=hdsgdgslnmimku-kfsstaeesa-n}}
** Category: [[orthology]]
+
{{#set: molecular-weight=699.111}}
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
== Pathway(s) ==
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
{{#set: direction=left-to-right}}
 
{{#set: ec-number=ec-1.3.8}}
 
{{#set: nb gene associated=3}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite OCTAPRENYL-METHYL-METHOXY-BENZQ

  • common-name:
    • 6-methoxy-3-methyl-2-all-trans-octaprenyl-1,4-benzoquinol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c
  • inchi-key:
    • hdsgdgslnmimku-kfsstaeesa-n
  • molecular-weight:
    • 699.111

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality