Difference between revisions of "PWY-882"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12483 CPD-12483] == * common-name: ** 1,7-dimethylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)n...")
 
(Created page with "Category:pathway == Pathway PWY-882 == * taxonomic-range: ** tax-33090 * common-name: ** l-ascorbate biosynthesis i (l-galactose pathway) == Reaction(s) found == * MANNP...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12483 CPD-12483] ==
+
== Pathway PWY-882 ==
 +
* taxonomic-range:
 +
** tax-33090
 
* common-name:
 
* common-name:
** 1,7-dimethylurate
+
** l-ascorbate biosynthesis i (l-galactose pathway)
* smiles:
+
== Reaction(s) found ==
** cn1(c(=o)nc2(=c1c(=o)n(c)c(=o)n2))
+
* [[MANNPISOM-RXN]]
* inchi-key:
+
* [[PHOSMANMUT-RXN]]
** nofnclgcujjpku-uhfffaoysa-n
+
* [[RXN-1882]]
* molecular-weight:
+
* [[RXN-1884]]
** 196.165
+
* [[RXNQT-4141]]
== Reaction(s) known to consume the compound ==
+
* [[RXNQT-4142]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) not found ==
* [[RXN-11520]]
+
* [NoneGALACTONOLACTONE-DEHYDROGENASE-RXN GALACTONOLACTONE-DEHYDROGENASE-RXN]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-7772 RXN-7772]
{{#set: common-name=1,7-dimethylurate}}
+
{{#set: taxonomic-range=tax-33090}}
{{#set: inchi-key=inchikey=nofnclgcujjpku-uhfffaoysa-n}}
+
{{#set: common-name=l-ascorbate biosynthesis i (l-galactose pathway)}}
{{#set: molecular-weight=196.165}}
+
{{#set: nb reaction found=6}}
 +
{{#set: completion rate=1.2}}
 +
{{#set: nb total reaction=5}}

Latest revision as of 10:59, 18 March 2021

Pathway PWY-882

  • taxonomic-range:
    • tax-33090
  • common-name:
    • l-ascorbate biosynthesis i (l-galactose pathway)

Reaction(s) found

Reaction(s) not found

  • [NoneGALACTONOLACTONE-DEHYDROGENASE-RXN GALACTONOLACTONE-DEHYDROGENASE-RXN]
  • [NoneRXN-7772 RXN-7772]