Difference between revisions of "LEUKOTRIENE-C4"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15035 RXN-15035] == * direction: ** left-to-right * common-name: ** lysophospholipase ** lyso-p...")
 
(Created page with "Category:metabolite == Metabolite LEUKOTRIENE-C4 == * common-name: ** leukotriene-c4 * smiles: ** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)nc(ccc(c(=o)[o-])[n+])=o)c(cccc(...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15035 RXN-15035] ==
+
== Metabolite LEUKOTRIENE-C4 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** lysophospholipase
+
** leukotriene-c4
** lyso-phosphatidylethanolaminelipase
+
* smiles:
* ec-number:
+
** cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)nc(ccc(c(=o)[o-])[n+])=o)c(cccc([o-])=o)o
** [http://enzyme.expasy.org/EC/3.1.1.5 ec-3.1.1.5]
+
* inchi-key:
== Reaction formula ==
+
** gwnvdxqdilpjig-nxolixfesa-l
* 1 [[CPD-8355]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[L-1-GLYCEROPHOSPHORYLETHANOL-AMINE]][c] '''+''' 1 [[OLEATE-CPD]][c] '''+''' 1 [[PROTON]][c]
+
* molecular-weight:
== Gene(s) associated with this reaction  ==
+
** 623.76
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to consume the compound ==
* Gene: [[SJ09511]]
+
* [[RXN66-336]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[LEUKOTRIENE-C4-SYNTHASE-RXN]]
* Gene: [[SJ19560]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=leukotriene-c4}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: inchi-key=inchikey=gwnvdxqdilpjig-nxolixfesa-l}}
** Category: [[orthology]]
+
{{#set: molecular-weight=623.76}}
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ21109]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ16427]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
* Gene: [[SJ16853]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ16448]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ04408]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
* Gene: [[SJ03124]]
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ06461]]
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ07752]]
 
** Category: [[annotation]]
 
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
</div>
 
== Pathway(s) ==
 
* [[PWY-7409]], phospholipid remodeling (phosphatidylethanolamine, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7409 PWY-7409]
 
** '''4''' reactions found over '''4''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=lysophospholipase|lyso-phosphatidylethanolaminelipase}}
 
{{#set: ec-number=ec-3.1.1.5}}
 
{{#set: nb gene associated=10}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite LEUKOTRIENE-C4

  • common-name:
    • leukotriene-c4
  • smiles:
    • cccccc=ccc=cc=cc=cc(scc(c(=o)ncc([o-])=o)nc(ccc(c(=o)[o-])[n+])=o)c(cccc([o-])=o)o
  • inchi-key:
    • gwnvdxqdilpjig-nxolixfesa-l
  • molecular-weight:
    • 623.76

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality