Difference between revisions of "P3I"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16558 RXN-16558] == * direction: ** left-to-right * common-name: ** enoyl-coa hydratase * ec-nu...") |
(Created page with "Category:metabolite == Metabolite P3I == * common-name: ** pppi * smiles: ** [o-]p(op(=o)(op([o-])(=o)[o-])[o-])([o-])=o * inchi-key: ** unxrwkveancorm-uhfffaoysa-i * mole...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite P3I == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** pppi |
− | * | + | * smiles: |
− | ** [ | + | ** [o-]p(op(=o)(op([o-])(=o)[o-])[o-])([o-])=o |
− | = | + | * inchi-key: |
− | + | ** unxrwkveancorm-uhfffaoysa-i | |
− | + | * molecular-weight: | |
− | + | ** 252.915 | |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[TRIPHOSPHATASE-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[4.2.3.12-RXN]] | |
− | * | + | * [[BTUR2-RXN]] |
− | + | * [[COBALADENOSYLTRANS-RXN]] | |
− | + | * [[DGTPTRIPHYDRO-RXN]] | |
− | + | * [[R344-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=pppi}} | |
− | + | {{#set: inchi-key=inchikey=unxrwkveancorm-uhfffaoysa-i}} | |
− | + | {{#set: molecular-weight=252.915}} | |
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | == | ||
− | * | ||
− | * | ||
− | == | ||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite P3I
- common-name:
- pppi
- smiles:
- [o-]p(op(=o)(op([o-])(=o)[o-])[o-])([o-])=o
- inchi-key:
- unxrwkveancorm-uhfffaoysa-i
- molecular-weight:
- 252.915