Difference between revisions of "MALTOTRIOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THI-P-SYN-RXN THI-P-SYN-RXN] == * direction: ** left-to-right * common-name: ** thiamine phosphate...")
 
(Created page with "Category:metabolite == Metabolite MALTOTRIOSE == * common-name: ** maltotriose * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o * inchi-key:...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=THI-P-SYN-RXN THI-P-SYN-RXN] ==
+
== Metabolite MALTOTRIOSE ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** thiamine phosphate synthase
+
** maltotriose
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.5.1.3 ec-2.5.1.3]
+
** c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o
== Reaction formula ==
+
* inchi-key:
* 1 [[AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[THZ-P]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[THIAMINE-P]][c]
+
** fygdtmlnykfzsv-dzoucchmsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ18183]]
+
** 504.441
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN0-5183]]
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN0-5182]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
* Gene: [[SJ20500]]
+
{{#set: common-name=maltotriose}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=fygdtmlnykfzsv-dzoucchmsa-n}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: molecular-weight=504.441}}
== Pathway(s) ==
 
* [[PWY-6908]], thiamine diphosphate biosynthesis IV (eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6908 PWY-6908]
 
** '''2''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY-7356]], thiamine salvage IV (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7356 PWY-7356]
 
** '''6''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-7357]], thiamine formation from pyrithiamine and oxythiamine (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7357 PWY-7357]
 
** '''4''' reactions found over '''6''' reactions in the full pathway
 
* [[PWY-6897]], thiamine salvage II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6897 PWY-6897]
 
** '''3''' reactions found over '''3''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22329 22329]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R03223 R03223]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P41835 P41835]
 
** [http://www.uniprot.org/uniprot/P71350 P71350]
 
** [http://www.uniprot.org/uniprot/O25514 O25514]
 
** [http://www.uniprot.org/uniprot/Q9PNL3 Q9PNL3]
 
** [http://www.uniprot.org/uniprot/Q9JWI2 Q9JWI2]
 
** [http://www.uniprot.org/uniprot/Q9ZL01 Q9ZL01]
 
** [http://www.uniprot.org/uniprot/P30137 P30137]
 
** [http://www.uniprot.org/uniprot/P39594 P39594]
 
** [http://www.uniprot.org/uniprot/P40386 P40386]
 
** [http://www.uniprot.org/uniprot/P72965 P72965]
 
** [http://www.uniprot.org/uniprot/O48881 O48881]
 
** [http://www.uniprot.org/uniprot/O34294 O34294]
 
** [http://www.uniprot.org/uniprot/Q9ZBL5 Q9ZBL5]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=thiamine phosphate synthase}}
 
{{#set: ec-number=ec-2.5.1.3}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=4}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite MALTOTRIOSE

  • common-name:
    • maltotriose
  • smiles:
    • c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o
  • inchi-key:
    • fygdtmlnykfzsv-dzoucchmsa-n
  • molecular-weight:
    • 504.441

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality