Difference between revisions of "GAMMA-LINOLENOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15635 RXN-15635] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:metabolite == Metabolite GAMMA-LINOLENOYL-COA == * common-name: ** γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15635 RXN-15635] ==
+
== Metabolite GAMMA-LINOLENOYL-COA ==
* direction:
+
* common-name:
** left-to-right
+
** γ-linolenoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.1.2.11 ec-2.1.2.11]
+
** cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[2-KETO-ISOVALERATE]][c] '''+''' 1 [[METHYLENETETRAHYDROMETHANOPTERIN]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[2-DEHYDROPANTOATE]][c] '''+''' 1 [[THMPT]][c]
+
** xzqyptbyqyzgru-fhdveodpsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ10361]]
+
** 1023.921
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-12777]]
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[1.14.19.3-RXN]]
== Pathway(s) ==
+
* [[RXN-16043]]
* [[PWY-6654]], phosphopantothenate biosynthesis III (archaebacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6654 PWY-6654]
+
== Reaction(s) of unknown directionality ==
** '''2''' reactions found over '''4''' reactions in the full pathway
+
{{#set: common-name=γ-linolenoyl-coa}}
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=xzqyptbyqyzgru-fhdveodpsa-j}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=1023.921}}
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
{{#set: direction=left-to-right}}
 
{{#set: ec-number=ec-2.1.2.11}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite GAMMA-LINOLENOYL-COA

  • common-name:
    • γ-linolenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • xzqyptbyqyzgru-fhdveodpsa-j
  • molecular-weight:
    • 1023.921

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality