|
|
| (9 intermediate revisions by 4 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLURS-RXN GLURS-RXN] == | + | == Metabolite CPD-15362 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** glutamate-trna ligase | + | ** (2e,11z)-icosa-2,11-dienoyl-coa |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/6.1.1.17 ec-6.1.1.17] | + | ** ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[ATP]][c] '''+''' 1 [[GLT]][c] '''+''' 1 [[GLT-tRNAs]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[Charged-GLT-tRNAs]][c] '''+''' 1 [[PPI]][c]
| + | ** laeceuxzoonxdy-nwgwhigpsa-j |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ12903]]
| + | ** 1053.99 |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | == Reaction(s) known to produce the compound == |
| − | * Gene: [[SJ07890]] | + | * [[RXN-14485]] |
| − | ** Category: [[annotation]] | + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | {{#set: common-name=(2e,11z)-icosa-2,11-dienoyl-coa}} |
| − | ** Category: [[orthology]]
| + | {{#set: inchi-key=inchikey=laeceuxzoonxdy-nwgwhigpsa-j}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | {{#set: molecular-weight=1053.99}} |
| − | == Pathway(s) == | |
| − | * [[PWY-5188]], tetrapyrrole biosynthesis I (from glutamate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5188 PWY-5188]
| |
| − | ** '''6''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[TRNA-CHARGING-PWY]], tRNA charging: [http://metacyc.org/META/NEW-IMAGE?object=TRNA-CHARGING-PWY TRNA-CHARGING-PWY]
| |
| − | ** '''21''' reactions found over '''21''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23541 23541]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R05578 R05578]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P47700 P47700]
| |
| − | ** [http://www.uniprot.org/uniprot/O52914 O52914]
| |
| − | ** [http://www.uniprot.org/uniprot/P43818 P43818]
| |
| − | ** [http://www.uniprot.org/uniprot/O26157 O26157]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZLJ1 Q9ZLJ1]
| |
| − | ** [http://www.uniprot.org/uniprot/O25360 O25360]
| |
| − | ** [http://www.uniprot.org/uniprot/O51345 O51345]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9Z7Z3 Q9Z7Z3]
| |
| − | ** [http://www.uniprot.org/uniprot/P96551 P96551]
| |
| − | ** [http://www.uniprot.org/uniprot/O67271 O67271]
| |
| − | ** [http://www.uniprot.org/uniprot/O83679 O83679]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZLZ7 Q9ZLZ7]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PP78 Q9PP78]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CDZ7 Q9CDZ7]
| |
| − | ** [http://www.uniprot.org/uniprot/O84451 O84451]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9X2I8 Q9X2I8]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JWT4 Q9JWT4]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZDK3 Q9ZDK3]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9X172 Q9X172]
| |
| − | ** [http://www.uniprot.org/uniprot/Q58772 Q58772]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZCT8 Q9ZCT8]
| |
| − | ** [http://www.uniprot.org/uniprot/P59690 P59690]
| |
| − | ** [http://www.uniprot.org/uniprot/Q43768 Q43768]
| |
| − | ** [http://www.uniprot.org/uniprot/Q43794 Q43794]
| |
| − | ** [http://www.uniprot.org/uniprot/P46655 P46655]
| |
| − | ** [http://www.uniprot.org/uniprot/P48525 P48525]
| |
| − | ** [http://www.uniprot.org/uniprot/P75114 P75114]
| |
| − | ** [http://www.uniprot.org/uniprot/Q49061 Q49061]
| |
| − | ** [http://www.uniprot.org/uniprot/P22249 P22249]
| |
| − | ** [http://www.uniprot.org/uniprot/P22250 P22250]
| |
| − | ** [http://www.uniprot.org/uniprot/P04805 P04805]
| |
| − | ** [http://www.uniprot.org/uniprot/P07814 P07814]
| |
| − | ** [http://www.uniprot.org/uniprot/P15189 P15189]
| |
| − | ** [http://www.uniprot.org/uniprot/O65253 O65253]
| |
| − | ** [http://www.uniprot.org/uniprot/O68055 O68055]
| |
| − | ** [http://www.uniprot.org/uniprot/O68142 O68142]
| |
| − | ** [http://www.uniprot.org/uniprot/O86528 O86528]
| |
| − | ** [http://www.uniprot.org/uniprot/O13775 O13775]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZFA3 Q9ZFA3]
| |
| − | ** [http://www.uniprot.org/uniprot/O82462 O82462]
| |
| − | </div>
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=glutamate-trna ligase}} | |
| − | {{#set: ec-number=ec-6.1.1.17}}
| |
| − | {{#set: nb gene associated=2}} | |
| − | {{#set: nb pathway associated=2}}
| |
| − | {{#set: reconstruction category=orthology|annotation}} | |
| − | {{#set: reconstruction tool=pathwaytools|pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
