Difference between revisions of "CPD-7733"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACACT7 ACACT7] == * direction: ** reversible * common-name: ** myristoyl-coa:acetylcoa c-myristoylt...") |
(Created page with "Category:metabolite == Metabolite CPD-7733 == * common-name: ** aurachin c * smiles: ** cc(c)=cccc(c)=cccc(c)=ccc2(c(c1(c=cc=cc=1n(c(c)=2)o))=o) * inchi-key: ** fihxchbehl...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-7733 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** aurachin c |
| − | == | + | * smiles: |
| − | + | ** cc(c)=cccc(c)=cccc(c)=ccc2(c(c1(c=cc=cc=1n(c(c)=2)o))=o) | |
| − | = | + | * inchi-key: |
| − | * | + | ** fihxchbehlcxeg-yefhwucqsa-n |
| − | ** | + | * molecular-weight: |
| − | ** | + | ** 379.541 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-15029]] | |
| − | * | + | * [[RXN-17335]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: common-name= | + | {{#set: common-name=aurachin c}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=fihxchbehlcxeg-yefhwucqsa-n}} |
| − | + | {{#set: molecular-weight=379.541}} | |
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-7733
- common-name:
- aurachin c
- smiles:
- cc(c)=cccc(c)=cccc(c)=ccc2(c(c1(c=cc=cc=1n(c(c)=2)o))=o)
- inchi-key:
- fihxchbehlcxeg-yefhwucqsa-n
- molecular-weight:
- 379.541
