Difference between revisions of "CPD-548"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYSTEAMINE-DIOXYGENASE-RXN CYSTEAMINE-DIOXYGENASE-RXN] == * direction: ** left-to-right * common-na...")
 
(Created page with "Category:metabolite == Metabolite CPD-548 == * common-name: ** s-formylglutathione * smiles: ** c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-] * inchi-key: ** fhxagoic...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYSTEAMINE-DIOXYGENASE-RXN CYSTEAMINE-DIOXYGENASE-RXN] ==
+
== Metabolite CPD-548 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** cysteamine dioxygenase
+
** s-formylglutathione
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.13.11.19 ec-1.13.11.19]
+
** c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-239]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[HYPOTAURINE]][c] '''+''' 1 [[PROTON]][c]
+
** fhxagoicbfgebf-bqbzgakwsa-m
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ00027]]
+
** 334.323
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN0-276]]
−
** Category: [[orthology]]
+
* [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ16671]]
+
* [[RXN-2962]]
−
** Category: [[annotation]]
+
* [[RXN0-276]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=s-formylglutathione}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: inchi-key=inchikey=fhxagoicbfgebf-bqbzgakwsa-m}}
−
== Pathway(s) ==
+
{{#set: molecular-weight=334.323}}
−
* [[PWY-7850]], taurine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7850 PWY-7850]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14410 14410]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R02467 R02467]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=cysteamine dioxygenase}}
 
−
{{#set: ec-number=ec-1.13.11.19}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-548

  • common-name:
    • s-formylglutathione
  • smiles:
    • c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-]
  • inchi-key:
    • fhxagoicbfgebf-bqbzgakwsa-m
  • molecular-weight:
    • 334.323

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-548&oldid=139775"