Difference between revisions of "CPD-548"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYSTEAMINE-DIOXYGENASE-RXN CYSTEAMINE-DIOXYGENASE-RXN] == * direction: ** left-to-right * common-na...") |
(Created page with "Category:metabolite == Metabolite CPD-548 == * common-name: ** s-formylglutathione * smiles: ** c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-] * inchi-key: ** fhxagoic...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-548 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** s-formylglutathione |
− | * | + | * smiles: |
− | ** | + | ** c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-] |
− | == | + | * inchi-key: |
− | + | ** fhxagoicbfgebf-bqbzgakwsa-m | |
− | = | + | * molecular-weight: |
− | + | ** 334.323 | |
− | * | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[RXN0-276]] |
− | + | * [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-2962]] |
− | + | * [[RXN0-276]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=s-formylglutathione}} | |
− | ** | + | {{#set: inchi-key=inchikey=fhxagoicbfgebf-bqbzgakwsa-m}} |
− | == | + | {{#set: molecular-weight=334.323}} |
− | * [[ | ||
− | |||
− | == | ||
− | * | ||
− | * | ||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite CPD-548
- common-name:
- s-formylglutathione
- smiles:
- c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-]
- inchi-key:
- fhxagoicbfgebf-bqbzgakwsa-m
- molecular-weight:
- 334.323