|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBOFLAVINSYNREDUC-RXN RIBOFLAVINSYNREDUC-RXN] == | + | == Metabolite CPD-15016 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** 5-amino-6-(5-phosphoribosylamino)uracil reductase | + | ** (4s)-4-hydroxy-2-oxoglutarate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/1.1.1.193 ec-1.1.1.193] | + | ** c(c(=o)c([o-])=o)c(c([o-])=o)o |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[CPD-602]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-1086]][c] '''+''' 1 [[NADP]][c]
| + | ** wxskvkpsmahcsg-reohclbhsa-l |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ22508]] | + | ** 160.083 |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[RXN-13990]] |
| − | ** Category: [[orthology]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[RXN-13990]] |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | * Gene: [[SJ02182]]
| + | {{#set: common-name=(4s)-4-hydroxy-2-oxoglutarate}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=wxskvkpsmahcsg-reohclbhsa-l}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | {{#set: molecular-weight=160.083}} |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ17550]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | ** Category: [[orthology]] | |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | == Pathway(s) == | |
| − | * [[RIBOSYN2-PWY]], flavin biosynthesis I (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=RIBOSYN2-PWY RIBOSYN2-PWY] | |
| − | ** '''8''' reactions found over '''9''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17847 17847]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R03458 R03458]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=5-amino-6-(5-phosphoribosylamino)uracil reductase}} | |
| − | {{#set: ec-number=ec-1.1.1.193}} | |
| − | {{#set: nb gene associated=3}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools|pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|saccharina_japonica_genome|output_pantograph_ectocarpus_siliculosus|output_pantograph_nannochloropsis_salina}}
| |
