Difference between revisions of "CPD-3766"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5161 == * common-name: ** α-d-man-(1→3)-β-d-man-(1→4)-β-d-glcnac-(1→4)-α-d-glcnac-diphosphodolic...") |
(Created page with "Category:metabolite == Metabolite CPD-3766 == * common-name: ** menadione * smiles: ** cc2(=cc(c1(c=cc=cc=1c2=o))=o) * inchi-key: ** mjvavzpdrwsrrc-uhfffaoysa-n * molecula...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-3766 == |
* common-name: | * common-name: | ||
− | ** | + | ** menadione |
+ | * smiles: | ||
+ | ** cc2(=cc(c1(c=cc=cc=1c2=o))=o) | ||
+ | * inchi-key: | ||
+ | ** mjvavzpdrwsrrc-uhfffaoysa-n | ||
+ | * molecular-weight: | ||
+ | ** 172.183 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[NADH-DEHYDROGENASE-QUINONE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=menadione}} |
+ | {{#set: inchi-key=inchikey=mjvavzpdrwsrrc-uhfffaoysa-n}} | ||
+ | {{#set: molecular-weight=172.183}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-3766
- common-name:
- menadione
- smiles:
- cc2(=cc(c1(c=cc=cc=1c2=o))=o)
- inchi-key:
- mjvavzpdrwsrrc-uhfffaoysa-n
- molecular-weight:
- 172.183