Difference between revisions of "L-1-PHOSPHATIDYL-ETHANOLAMINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DETHIOBIOTIN == * common-name: ** dethiobiotin * smiles: ** cc1(nc(=o)nc1cccccc(=o)[o-]) * inchi-key: ** autolbmxddtrrt-uhfffaoysa-m * mo...") |
(Created page with "Category:metabolite == Metabolite L-1-PHOSPHATIDYL-ETHANOLAMINE == * common-name: ** an l-1-phosphatidylethanolamine == Reaction(s) known to consume the compound == * 2....") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-1-PHOSPHATIDYL-ETHANOLAMINE == |
* common-name: | * common-name: | ||
− | ** | + | ** an l-1-phosphatidylethanolamine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[2. | + | * [[2.1.1.17-RXN]] |
− | * [[RXN- | + | * [[RXN-1382]] |
+ | * [[RXN0-6725]] | ||
+ | * [[RXN0-6952]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]] |
+ | * [[RXN-1382]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an l-1-phosphatidylethanolamine}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite L-1-PHOSPHATIDYL-ETHANOLAMINE
- common-name:
- an l-1-phosphatidylethanolamine