Difference between revisions of "5-DEHYDROGLUCONATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Mitochondrial-Preproteins == * common-name: ** a mitochondrial preprotein including a mitochondrial targeting sequence == Reaction(s) kno...")
(Created page with "Category:metabolite == Metabolite 5-DEHYDROGLUCONATE == * common-name: ** 5-dehydro-d-gluconate * smiles: ** c(o)c(=o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** izsrjdgcgrauar-...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Mitochondrial-Preproteins ==
+
== Metabolite 5-DEHYDROGLUCONATE ==
 
* common-name:
 
* common-name:
** a mitochondrial preprotein including a mitochondrial targeting sequence
+
** 5-dehydro-d-gluconate
 +
* smiles:
 +
** c(o)c(=o)c(o)c(o)c(o)c(=o)[o-]
 +
* inchi-key:
 +
** izsrjdgcgrauar-mrozadkfsa-m
 +
* molecular-weight:
 +
** 193.133
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.4.24.64-RXN]]
+
* [[GLUCONATE-5-DEHYDROGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12107]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a mitochondrial preprotein including a mitochondrial targeting sequence}}
+
{{#set: common-name=5-dehydro-d-gluconate}}
 +
{{#set: inchi-key=inchikey=izsrjdgcgrauar-mrozadkfsa-m}}
 +
{{#set: molecular-weight=193.133}}

Latest revision as of 11:11, 18 March 2021

Metabolite 5-DEHYDROGLUCONATE

  • common-name:
    • 5-dehydro-d-gluconate
  • smiles:
    • c(o)c(=o)c(o)c(o)c(o)c(=o)[o-]
  • inchi-key:
    • izsrjdgcgrauar-mrozadkfsa-m
  • molecular-weight:
    • 193.133

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality