Difference between revisions of "CPD0-2107"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6224 == * common-name: ** gibberellin a34 * smiles: ** c=c1(c3(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c(o)2)([ch](cc3)4)5)(c)))c([o-])=o)))...")
(Created page with "Category:metabolite == Metabolite CPD0-2107 == * common-name: ** (s)-3-hydroxydodecanoyl-coa * smiles: ** cccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-6224 ==
+
== Metabolite CPD0-2107 ==
 
* common-name:
 
* common-name:
** gibberellin a34
+
** (s)-3-hydroxydodecanoyl-coa
 
* smiles:
 
* smiles:
** c=c1(c3(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c(o)2)([ch](cc3)4)5)(c)))c([o-])=o)))
+
** cccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
 
* inchi-key:
 
* inchi-key:
** igziqajjxgrajf-oqaxfvlusa-m
+
** ijflxrcjwpkgkj-lxixeqkwsa-j
 
* molecular-weight:
 
* molecular-weight:
** 347.387
+
** 961.807
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ECOAH5]]
 +
* [[ECOAH5h]]
 +
* [[ECOAH5m]]
 +
* [[HACD5]]
 +
* [[HACD5h]]
 +
* [[HACD5m]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-6550]]
+
* [[ECOAH5]]
 +
* [[ECOAH5h]]
 +
* [[ECOAH5m]]
 +
* [[HACD5]]
 +
* [[HACD5h]]
 +
* [[HACD5m]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gibberellin a34}}
+
{{#set: common-name=(s)-3-hydroxydodecanoyl-coa}}
{{#set: inchi-key=inchikey=igziqajjxgrajf-oqaxfvlusa-m}}
+
{{#set: inchi-key=inchikey=ijflxrcjwpkgkj-lxixeqkwsa-j}}
{{#set: molecular-weight=347.387}}
+
{{#set: molecular-weight=961.807}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD0-2107

  • common-name:
    • (s)-3-hydroxydodecanoyl-coa
  • smiles:
    • cccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
  • inchi-key:
    • ijflxrcjwpkgkj-lxixeqkwsa-j
  • molecular-weight:
    • 961.807

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality