Difference between revisions of "PWY-7783"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13398 CPD-13398] == * common-name: ** l-alanyl-l-leucine * smiles: ** cc(c)cc(c([o-])=o)nc(...")
 
(Created page with "Category:pathway == Pathway PWY-7783 == * taxonomic-range: ** tax-33208 * common-name: ** plasmalogen degradation == Reaction(s) found == * RXN-17735 * RXN-17736 =...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13398 CPD-13398] ==
+
== Pathway PWY-7783 ==
 +
* taxonomic-range:
 +
** tax-33208
 
* common-name:
 
* common-name:
** l-alanyl-l-leucine
+
** plasmalogen degradation
* smiles:
+
== Reaction(s) found ==
** cc(c)cc(c([o-])=o)nc(c(c)[n+])=o
+
* [[RXN-17735]]
* inchi-key:
+
* [[RXN-17736]]
** rdikfprvljlmer-bqbzgakwsa-n
+
== Reaction(s) not found ==
* molecular-weight:
+
* [None3.3.2.5-RXN 3.3.2.5-RXN]
** 202.253
+
* [NoneRXN-17741 RXN-17741]
== Reaction(s) known to consume the compound ==
+
* [None3.3.2.2-RXN 3.3.2.2-RXN]
* [[RXN0-6979]]
+
* [NoneRXN-17738 RXN-17738]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-17740 RXN-17740]
== Reaction(s) of unknown directionality ==
+
* [NoneRXN-17737 RXN-17737]
{{#set: common-name=l-alanyl-l-leucine}}
+
{{#set: taxonomic-range=tax-33208}}
{{#set: inchi-key=inchikey=rdikfprvljlmer-bqbzgakwsa-n}}
+
{{#set: common-name=plasmalogen degradation}}
{{#set: molecular-weight=202.253}}
+
{{#set: nb reaction found=2}}
 +
{{#set: completion rate=0.25}}
 +
{{#set: nb total reaction=8}}

Latest revision as of 10:59, 18 March 2021

Pathway PWY-7783

  • taxonomic-range:
    • tax-33208
  • common-name:
    • plasmalogen degradation

Reaction(s) found

Reaction(s) not found

  • [None3.3.2.5-RXN 3.3.2.5-RXN]
  • [NoneRXN-17741 RXN-17741]
  • [None3.3.2.2-RXN 3.3.2.2-RXN]
  • [NoneRXN-17738 RXN-17738]
  • [NoneRXN-17740 RXN-17740]
  • [NoneRXN-17737 RXN-17737]