Difference between revisions of "MRNAs-With-PolyA-Tails"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite THREO-DS-ISO-CITRATE == * common-name: ** d-threo-isocitrate * smiles: ** c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-] * inchi-key: ** odblhexud...") |
(Created page with "Category:metabolite == Metabolite mRNAs-With-PolyA-Tails == * common-name: ** a mrna with poly(a) tail == Reaction(s) known to consume the compound == * 3.1.13.4-RXN =...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite mRNAs-With-PolyA-Tails == |
* common-name: | * common-name: | ||
− | ** | + | ** a mrna with poly(a) tail |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3.1.13.4-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a mrna with poly(a) tail}} |
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite mRNAs-With-PolyA-Tails
- common-name:
- a mrna with poly(a) tail