Difference between revisions of "CPD-177"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13518 == * common-name: ** nω-hydroxy-l-arginine * smiles: ** c(nc(no)=[n+])ccc([n+])c([o-])=o * inchi-key: ** fqwravymzulpnk-b...")
(Created page with "Category:metabolite == Metabolite CPD-177 == * common-name: ** a 1-phosphatidyl-1d-myo-inositol 3-phosphate == Reaction(s) known to consume the compound == * 2.7.1.150-R...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13518 ==
+
== Metabolite CPD-177 ==
 
* common-name:
 
* common-name:
** nω-hydroxy-l-arginine
+
** a 1-phosphatidyl-1d-myo-inositol 3-phosphate
* smiles:
 
** c(nc(no)=[n+])ccc([n+])c([o-])=o
 
* inchi-key:
 
** fqwravymzulpnk-bypyzucnsa-o
 
* molecular-weight:
 
** 191.209
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13565]]
+
* [[2.7.1.150-RXN]]
 +
* [[PHOSPHATIDYLINOSITOL-3-PHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13564]]
+
* [[1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN]]
 +
* [[3.1.3.66-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nω-hydroxy-l-arginine}}
+
{{#set: common-name=a 1-phosphatidyl-1d-myo-inositol 3-phosphate}}
{{#set: inchi-key=inchikey=fqwravymzulpnk-bypyzucnsa-o}}
 
{{#set: molecular-weight=191.209}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-177

  • common-name:
    • a 1-phosphatidyl-1d-myo-inositol 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality