Difference between revisions of "CPD-177"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13518 == * common-name: ** nω-hydroxy-l-arginine * smiles: ** c(nc(no)=[n+])ccc([n+])c([o-])=o * inchi-key: ** fqwravymzulpnk-b...") |
(Created page with "Category:metabolite == Metabolite CPD-177 == * common-name: ** a 1-phosphatidyl-1d-myo-inositol 3-phosphate == Reaction(s) known to consume the compound == * 2.7.1.150-R...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-177 == |
* common-name: | * common-name: | ||
− | ** | + | ** a 1-phosphatidyl-1d-myo-inositol 3-phosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[2.7.1.150-RXN]] |
+ | * [[PHOSPHATIDYLINOSITOL-3-PHOSPHATASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN]] |
+ | * [[3.1.3.66-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 1-phosphatidyl-1d-myo-inositol 3-phosphate}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-177
- common-name:
- a 1-phosphatidyl-1d-myo-inositol 3-phosphate