Difference between revisions of "CPD66-39"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TDP == * common-name: ** dtdp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])[o-])o2)) * inchi-key: ** ujlxyodchael...") |
(Created page with "Category:metabolite == Metabolite CPD66-39 == * common-name: ** a 2,3,4-saturated fatty acid == Reaction(s) known to consume the compound == * ACYLCOASYN-RXN * TRANS...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD66-39 == |
* common-name: | * common-name: | ||
− | ** | + | ** a 2,3,4-saturated fatty acid |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ACYLCOASYN-RXN]] |
− | * [[ | + | * [[TRANS-RXN0-623]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[THIOESTER-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a 2,3,4-saturated fatty acid}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD66-39
- common-name:
- a 2,3,4-saturated fatty acid