Difference between revisions of "N6-Methyladenine-containing-mRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-KETO-ADIPYL-COA == * common-name: ** 3-oxoadipyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1...")
(Created page with "Category:metabolite == Metabolite N6-Methyladenine-containing-mRNAs == * common-name: ** an n6-methyladenine in mrna == Reaction(s) known to consume the compound == * RX...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-KETO-ADIPYL-COA ==
+
== Metabolite N6-Methyladenine-containing-mRNAs ==
 
* common-name:
 
* common-name:
** 3-oxoadipyl-coa
+
** an n6-methyladenine in mrna
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** vkkkaapgxhwxoo-biewrjsysa-i
 
* molecular-weight:
 
** 904.605
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-2044]]
+
* [[RXN-17811]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-2044]]
+
* [[RXN-17811]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxoadipyl-coa}}
+
{{#set: common-name=an n6-methyladenine in mrna}}
{{#set: inchi-key=inchikey=vkkkaapgxhwxoo-biewrjsysa-i}}
 
{{#set: molecular-weight=904.605}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite N6-Methyladenine-containing-mRNAs

  • common-name:
    • an n6-methyladenine in mrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality