Difference between revisions of "CPD-4203"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Light == * common-name: ** hν == Reaction(s) known to consume the compound == * DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN * ExchangeS...") |
(Created page with "Category:metabolite == Metabolite CPD-4203 == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-diphosphate * smiles: ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)(...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-4203 == |
* common-name: | * common-name: | ||
| − | ** | + | ** n6-(δ2-isopentenyl)-adenosine 5'-diphosphate |
| + | * smiles: | ||
| + | ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])[o-])([o-])=o)o)o))c=nc=23)))c | ||
| + | * inchi-key: | ||
| + | ** vxmxkdahjurhen-sdbhatresa-k | ||
| + | * molecular-weight: | ||
| + | ** 492.298 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-4311]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-4305]] |
| − | * [[ | + | * [[RXN-4311]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-diphosphate}} |
| + | {{#set: inchi-key=inchikey=vxmxkdahjurhen-sdbhatresa-k}} | ||
| + | {{#set: molecular-weight=492.298}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-4203
- common-name:
- n6-(δ2-isopentenyl)-adenosine 5'-diphosphate
- smiles:
- cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])[o-])([o-])=o)o)o))c=nc=23)))c
- inchi-key:
- vxmxkdahjurhen-sdbhatresa-k
- molecular-weight:
- 492.298
