Difference between revisions of "METHYLENE-THF-GLU-N"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD66-27 == * common-name: ** pregn-5-ene-3,20-dione-17-ol * smiles: ** cc(=o)c4(o)(ccc2(c(c)(ccc1(c3(c)(c(=ccc12)cc(=o)cc3)))4)) * inchi...")
(Created page with "Category:metabolite == Metabolite METHYLENE-THF-GLU-N == * common-name: ** a 5,10-methylene-tetrahydrofolate == Reaction(s) known to consume the compound == * 1.5.1.15-R...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD66-27 ==
+
== Metabolite METHYLENE-THF-GLU-N ==
 
* common-name:
 
* common-name:
** pregn-5-ene-3,20-dione-17-ol
+
** a 5,10-methylene-tetrahydrofolate
* smiles:
 
** cc(=o)c4(o)(ccc2(c(c)(ccc1(c3(c)(c(=ccc12)cc(=o)cc3)))4))
 
* inchi-key:
 
** rcfjdvcranozel-uhfffaoysa-n
 
* molecular-weight:
 
** 330.466
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-350]]
+
* [[1.5.1.15-RXN]]
 +
* [[1.5.1.20-RXN]]
 +
* [[3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN]]
 +
* [[GCVT-RXN]]
 +
* [[GLYOHMETRANS-RXN]]
 +
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
 +
* [[RXN0-2921]]
 +
* [[THYMIDYLATESYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-350]]
+
* [[3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN]]
 +
* [[GCVT-RXN]]
 +
* [[GLYOHMETRANS-RXN]]
 +
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
 +
* [[RXN0-2921]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pregn-5-ene-3,20-dione-17-ol}}
+
{{#set: common-name=a 5,10-methylene-tetrahydrofolate}}
{{#set: inchi-key=inchikey=rcfjdvcranozel-uhfffaoysa-n}}
 
{{#set: molecular-weight=330.466}}
 

Latest revision as of 11:13, 18 March 2021