Difference between revisions of "ALGINATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-365 == * common-name: ** 1-keto-d-chiro-inositol * smiles: ** c1(o)(c(o)c(o)c(=o)c(o)c(o)1) * inchi-key: ** vyegbdhsghxogt-qfycrykcsa...") |
(Created page with "Category:metabolite == Metabolite ALGINATE == * common-name: ** alginate == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == *...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ALGINATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** alginate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9839]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=alginate}} |
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite ALGINATE
- common-name:
- alginate
