Difference between revisions of "CPD-12860"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4822 == * common-name: ** kanamycin b * smiles: ** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]...")
(Created page with "Category:metabolite == Metabolite CPD-12860 == * common-name: ** 4α-methyl-5α-cholesta-7,24-dien-3β-ol * inchi-key: ** mupkqzrbzsoulx-sponxpensa-n * molec...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-4822 ==
+
== Metabolite CPD-12860 ==
 
* common-name:
 
* common-name:
** kanamycin b
+
** 4α-methyl-5α-cholesta-7,24-dien-3β-ol
* smiles:
 
** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
 
 
* inchi-key:
 
* inchi-key:
** skklouvuunmcje-fqsmhnglsa-s
+
** mupkqzrbzsoulx-sponxpensa-n
 
* molecular-weight:
 
* molecular-weight:
** 488.557
+
** 398.671
 +
* smiles:
 +
** cc(c)=ccc[c@@h](c)[c@@h]3(cc[c@@h]4(c1([c@@h]([c@]2(cc[c@h](o)[c@@h](c)[c@h](cc=1)2)(c))cc[c@](c)34)))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14553]]
+
* [[RXN-21833]]
* [[RXN-15287]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=kanamycin b}}
+
{{#set: common-name=4α-methyl-5α-cholesta-7,24-dien-3β-ol}}
{{#set: inchi-key=inchikey=skklouvuunmcje-fqsmhnglsa-s}}
+
{{#set: inchi-key=inchikey=mupkqzrbzsoulx-sponxpensa-n}}
{{#set: molecular-weight=488.557}}
+
{{#set: molecular-weight=398.671}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-12860

  • common-name:
    • 4α-methyl-5α-cholesta-7,24-dien-3β-ol
  • inchi-key:
    • mupkqzrbzsoulx-sponxpensa-n
  • molecular-weight:
    • 398.671
  • smiles:
    • cc(c)=ccc[c@@h](c)[c@@h]3(cc[c@@h]4(c1([c@@h]([c@]2(cc[c@h](o)[c@@h](c)[c@h](cc=1)2)(c))cc[c@](c)34)))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality