Difference between revisions of "CPD-4211"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PROPIONYL-COA == * common-name: ** propanoyl-coa * smiles: ** ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c...") |
(Created page with "Category:metabolite == Metabolite CPD-4211 == * common-name: ** dimethylallyl diphosphate * smiles: ** cc(c)=ccop(=o)([o-])op(=o)([o-])[o-] * inchi-key: ** cbidrcwhncksto-...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-4211 == |
* common-name: | * common-name: | ||
| − | ** | + | ** dimethylallyl diphosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=ccop(=o)([o-])op(=o)([o-])[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cbidrcwhncksto-uhfffaoysa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 243.069 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GPPS]] |
| − | * [[ | + | * [[GPPSYN-RXN]] |
| − | * [[ | + | * [[IPPISOM-RXN]] |
| − | * [[ | + | * [[RXN-4303]] |
| + | * [[RXN-4305]] | ||
| + | * [[RXN-4307]] | ||
| + | * [[RXN-7810]] | ||
| + | * [[RXN-7811]] | ||
| + | * [[RXN-7813]] | ||
| + | * [[RXN0-6274]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GPPSYN-RXN]] |
| − | * [[ | + | * [[IDI]] |
| − | + | * [[IDS2]] | |
| − | * [[ | + | * [[IPPISOM-RXN]] |
| − | * [[ | + | * [[RXN0-884]] |
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dimethylallyl diphosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cbidrcwhncksto-uhfffaoysa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=243.069}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-4211
- common-name:
- dimethylallyl diphosphate
- smiles:
- cc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
- inchi-key:
- cbidrcwhncksto-uhfffaoysa-k
- molecular-weight:
- 243.069
