Difference between revisions of "COPROPORPHYRIN III"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite His-tRNA-2-O-MeAdenosine4 == * common-name: ** a 2'-o-methyladenosine4 in trnahis == Reaction(s) known to consume the compound == == Reac...") |
(Created page with "Category:metabolite == Metabolite COPROPORPHYRIN_III == * common-name: ** coproporphyrin iii * smiles: ** cc1(=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite COPROPORPHYRIN_III == |
* common-name: | * common-name: | ||
| − | ** | + | ** coproporphyrin iii |
| + | * smiles: | ||
| + | ** cc1(=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(ccc(=o)[o-])=c(c)c(=cc(=c(ccc([o-])=o)1)n2)n=3))n4))=n5))) | ||
| + | * inchi-key: | ||
| + | ** jwfcywsmnrlxlx-ujjxfscmsa-j | ||
| + | * molecular-weight: | ||
| + | ** 650.687 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-17518]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-17517]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=coproporphyrin iii}} |
| + | {{#set: inchi-key=inchikey=jwfcywsmnrlxlx-ujjxfscmsa-j}} | ||
| + | {{#set: molecular-weight=650.687}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite COPROPORPHYRIN_III
- common-name:
- coproporphyrin iii
- smiles:
- cc1(=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(ccc(=o)[o-])=c(c)c(=cc(=c(ccc([o-])=o)1)n2)n=3))n4))=n5)))
- inchi-key:
- jwfcywsmnrlxlx-ujjxfscmsa-j
- molecular-weight:
- 650.687
