Difference between revisions of "5-OXOPROLINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DOPAMINE == * common-name: ** dopamine * smiles: ** c(cc1(c=c(c(=cc=1)o)o))[n+] * inchi-key: ** vyfyytllbukuhu-uhfffaoysa-o * molecular-w...") |
(Created page with "Category:metabolite == Metabolite 5-OXOPROLINE == * common-name: ** 5-oxo-l-proline * smiles: ** c(=o)(c1(nc(cc1)=o))[o-] * inchi-key: ** odhctxknwhhxjc-vkhmyheasa-m * mol...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5-OXOPROLINE == |
* common-name: | * common-name: | ||
− | ** | + | ** 5-oxo-l-proline |
* smiles: | * smiles: | ||
− | ** c( | + | ** c(=o)(c1(nc(cc1)=o))[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** odhctxknwhhxjc-vkhmyheasa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 128.107 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]] |
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN]] |
+ | * [[RXN-15681]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=5-oxo-l-proline}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=odhctxknwhhxjc-vkhmyheasa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=128.107}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite 5-OXOPROLINE
- common-name:
- 5-oxo-l-proline
- smiles:
- c(=o)(c1(nc(cc1)=o))[o-]
- inchi-key:
- odhctxknwhhxjc-vkhmyheasa-m
- molecular-weight:
- 128.107