Difference between revisions of "NMNH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-palmitoyl-ACPs == * common-name: ** a 3-oxo-palmitoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9540 == React...")
(Created page with "Category:metabolite == Metabolite NMNH == * common-name: ** reduced β-nicotinamide d-ribonucleotide * smiles: ** c1(=c(cc=cn1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))c(n)=o...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-oxo-palmitoyl-ACPs ==
+
== Metabolite NMNH ==
 
* common-name:
 
* common-name:
** a 3-oxo-palmitoyl-[acp]
+
** reduced β-nicotinamide d-ribonucleotide
 +
* smiles:
 +
** c1(=c(cc=cn1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))c(n)=o)
 +
* inchi-key:
 +
** xqhmusrslnrvga-turqnecasa-l
 +
* molecular-weight:
 +
** 334.222
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9540]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9539]]
+
* [[RXN0-4401]]
* [[RXN-9654]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 3-oxo-palmitoyl-[acp]}}
+
{{#set: common-name=reduced β-nicotinamide d-ribonucleotide}}
 +
{{#set: inchi-key=inchikey=xqhmusrslnrvga-turqnecasa-l}}
 +
{{#set: molecular-weight=334.222}}

Latest revision as of 11:15, 18 March 2021

Metabolite NMNH

  • common-name:
    • reduced β-nicotinamide d-ribonucleotide
  • smiles:
    • c1(=c(cc=cn1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))c(n)=o)
  • inchi-key:
    • xqhmusrslnrvga-turqnecasa-l
  • molecular-weight:
    • 334.222

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality