Difference between revisions of "Trans-3-cis-5-dienoyl-CoA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12932 == * common-name: ** all-trans-3,4-didehydrolycopene * smiles: ** cc(c)=cc=cc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)...")
(Created page with "Category:metabolite == Metabolite trans-3-cis-5-dienoyl-CoA == * common-name: ** a (3e,5z)-alkan-3,5-dienoyl-coa == Reaction(s) known to consume the compound == * RXN-12...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-12932 ==
+
== Metabolite trans-3-cis-5-dienoyl-CoA ==
 
* common-name:
 
* common-name:
−
** all-trans-3,4-didehydrolycopene
+
** a (3e,5z)-alkan-3,5-dienoyl-coa
−
* smiles:
 
−
** cc(c)=cc=cc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)ccc=c(c)c
 
−
* inchi-key:
 
−
** ocmsupsdvxkdfy-fqmrbfjqsa-n
 
−
* molecular-weight:
 
−
** 534.867
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-11976]]
+
* [[RXN-12519]]
−
* [[RXN-11999]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-12413]]
+
* [[RXN-12519]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=all-trans-3,4-didehydrolycopene}}
+
{{#set: common-name=a (3e,5z)-alkan-3,5-dienoyl-coa}}
−
{{#set: inchi-key=inchikey=ocmsupsdvxkdfy-fqmrbfjqsa-n}}
 
−
{{#set: molecular-weight=534.867}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite trans-3-cis-5-dienoyl-CoA

  • common-name:
    • a (3e,5z)-alkan-3,5-dienoyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Trans-3-cis-5-dienoyl-CoA&oldid=138883"